C8H16N2O2 — CID 141489709
N'-(3,3-dimethoxypropyl)-N-ethylmethanediimine (PubChem CID 141489709) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is N'-(3,3-dimethoxypropyl)-N-ethylmethanediimine.
| Compound Name | N'-(3,3-dimethoxypropyl)-N-ethylmethanediimine |
|---|---|
| PubChem CID | 141489709 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | N'-(3,3-dimethoxypropyl)-N-ethylmethanediimine |
| SMILES | CCN=C=NCCC(OC)OC |
| InChI | InChI=1S/C8H16N2O2/c1-4-9-7-10-6-5-8(11-2)12-3/h8H,4-6H2,1-3H3 |
| InChIKey | GODIXJSZOIVYDO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|