N-ethyl-N'-(4-methylpentyl)methanediimine chloride

C9H18ClN2- — CID 169423866

IUPACN-ethyl-N'-(4-methylpentyl)methanediimine chloride
SMILESCCN=C=NCCCC(C)C.[Cl-]
InChIInChI=1S/C9H18N2.ClH/c1-4-10-8-11-7-5-6-9(2)3;/h9H,4-7H2,1-3H3;1H/p-1
InChIKeyLHXCBHVAYLQAKV-UHFFFAOYSA-M
MW189.71 g/mol
LogP-0.38
Rot. Bonds5

About N-ethyl-N'-(4-methylpentyl)methanediimine chloride

N-ethyl-N'-(4-methylpentyl)methanediimine chloride (PubChem CID 169423866) has the molecular formula C9H18ClN2- and a molecular weight of 189.71 g/mol. Its IUPAC name is N-ethyl-N'-(4-methylpentyl)methanediimine chloride.

Molecular Properties

Compound NameN-ethyl-N'-(4-methylpentyl)methanediimine chloride
PubChem CID169423866
Molecular FormulaC9H18ClN2-
Molecular Weight189.71 g/mol
Exact Mass189.12
IUPAC NameN-ethyl-N'-(4-methylpentyl)methanediimine chloride
SMILESCCN=C=NCCCC(C)C.[Cl-]
InChIInChI=1S/C9H18N2.ClH/c1-4-10-8-11-7-5-6-9(2)3;/h9H,4-7H2,1-3H3;1H/p-1
InChIKeyLHXCBHVAYLQAKV-UHFFFAOYSA-M
XLogP-0.38
TPSA24.72 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.71
LogP ≤ 5-0.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze N-ethyl-N'-(4-methylpentyl)methanediimine chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-ethyl-N'-(4-methylpentyl)methanediimine chloride?
The IUPAC name of N-ethyl-N'-(4-methylpentyl)methanediimine chloride (CID 169423866) is N-ethyl-N'-(4-methylpentyl)methanediimine chloride.
What is the SMILES notation for N-ethyl-N'-(4-methylpentyl)methanediimine chloride?
The canonical SMILES for N-ethyl-N'-(4-methylpentyl)methanediimine chloride is CCN=C=NCCCC(C)C.[Cl-].
What is the InChIKey of N-ethyl-N'-(4-methylpentyl)methanediimine chloride?
The InChIKey is LHXCBHVAYLQAKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18N2.ClH/c1-4-10-8-11-7-5-6-9(2)3;/h9H,4-7H2,1-3H3;1H/p-1.
What are the key properties of N-ethyl-N'-(4-methylpentyl)methanediimine chloride?
N-ethyl-N'-(4-methylpentyl)methanediimine chloride has a molecular weight of 189.71 g/mol, XLogP of -0.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-(4-methylpentyl)methanediimine chloride is sourced from PubChem (CID 169423866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).