About N-ethyl-N'-(4-methylpentyl)methanediimine chloride
N-ethyl-N'-(4-methylpentyl)methanediimine chloride (PubChem CID 169423866) has the molecular formula C9H18ClN2-
and a molecular weight of 189.71 g/mol. Its IUPAC name is N-ethyl-N'-(4-methylpentyl)methanediimine chloride.
Molecular Properties
| Compound Name | N-ethyl-N'-(4-methylpentyl)methanediimine chloride |
| PubChem CID | 169423866 |
| Molecular Formula | C9H18ClN2- |
| Molecular Weight | 189.71 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | N-ethyl-N'-(4-methylpentyl)methanediimine chloride |
| SMILES | CCN=C=NCCCC(C)C.[Cl-] |
| InChI | InChI=1S/C9H18N2.ClH/c1-4-10-8-11-7-5-6-9(2)3;/h9H,4-7H2,1-3H3;1H/p-1 |
| InChIKey | LHXCBHVAYLQAKV-UHFFFAOYSA-M |
| XLogP | -0.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.71 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-(4-methylpentyl)methanediimine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-(4-methylpentyl)methanediimine chloride?
The IUPAC name of N-ethyl-N'-(4-methylpentyl)methanediimine chloride (CID 169423866) is N-ethyl-N'-(4-methylpentyl)methanediimine chloride.
What is the SMILES notation for N-ethyl-N'-(4-methylpentyl)methanediimine chloride?
The canonical SMILES for N-ethyl-N'-(4-methylpentyl)methanediimine chloride is CCN=C=NCCCC(C)C.[Cl-].
What is the InChIKey of N-ethyl-N'-(4-methylpentyl)methanediimine chloride?
The InChIKey is LHXCBHVAYLQAKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18N2.ClH/c1-4-10-8-11-7-5-6-9(2)3;/h9H,4-7H2,1-3H3;1H/p-1.
What are the key properties of N-ethyl-N'-(4-methylpentyl)methanediimine chloride?
N-ethyl-N'-(4-methylpentyl)methanediimine chloride has a molecular weight of 189.71 g/mol, XLogP of -0.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-(4-methylpentyl)methanediimine chloride is sourced from PubChem (CID 169423866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).