C6H11F6NO3S — CID 141491827
dimethylazanium;1,1,2,4,4,4-hexafluorobutane-1-sulfonate (PubChem CID 141491827) has the molecular formula C6H11F6NO3S and a molecular weight of 291.21 g/mol. Its IUPAC name is dimethylazanium;1,1,2,4,4,4-hexafluorobutane-1-sulfonate.
| Compound Name | dimethylazanium;1,1,2,4,4,4-hexafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141491827 |
| Molecular Formula | C6H11F6NO3S |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | dimethylazanium;1,1,2,4,4,4-hexafluorobutane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])C(F)(F)C(F)CC(F)(F)F |
| InChI | InChI=1S/C4H4F6O3S.C2H7N/c5-2(1-3(6,7)8)4(9,10)14(11,12)13;1-3-2/h2H,1H2,(H,11,12,13);3H,1-2H3 |
| InChIKey | FHFMZDKQMYPHNV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|