C11H21NO — CID 1415635
(2R,5S)-5-tert-butyl-1,2-dimethylpiperidin-3-one (PubChem CID 1415635) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (2R,5S)-5-tert-butyl-1,2-dimethylpiperidin-3-one.
| Compound Name | (2R,5S)-5-tert-butyl-1,2-dimethylpiperidin-3-one |
|---|---|
| PubChem CID | 1415635 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (2R,5S)-5-tert-butyl-1,2-dimethylpiperidin-3-one |
| SMILES | C[C@@H]1C(=O)C[C@@H](C(C)(C)C)CN1C |
| InChI | InChI=1S/C11H21NO/c1-8-10(13)6-9(7-12(8)5)11(2,3)4/h8-9H,6-7H2,1-5H3/t8-,9-/m1/s1 |
| InChIKey | XDPTWFUYZSATFF-RKDXNWHRSA-N |
| XLogP | 1.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |