C10H20NO+ — CID 6984988
(2R,5R)-5-tert-butyl-2-methylpiperidin-1-ium-3-one (PubChem CID 6984988) has the molecular formula C10H20NO+ and a molecular weight of 170.28 g/mol. Its IUPAC name is (2R,5R)-5-tert-butyl-2-methylpiperidin-1-ium-3-one.
| Compound Name | (2R,5R)-5-tert-butyl-2-methylpiperidin-1-ium-3-one |
|---|---|
| PubChem CID | 6984988 |
| Molecular Formula | C10H20NO+ |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | (2R,5R)-5-tert-butyl-2-methylpiperidin-1-ium-3-one |
| SMILES | C[C@H]1[NH2+]C[C@@H](C(C)(C)C)CC1=O |
| InChI | InChI=1S/C10H19NO/c1-7-9(12)5-8(6-11-7)10(2,3)4/h7-8,11H,5-6H2,1-4H3/p+1/t7-,8+/m1/s1 |
| InChIKey | JRMBCPQPNZTSPR-SFYZADRCSA-O |
| XLogP | 0.57 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |