C10H18N7S+ — CID 1419904
[amino-[(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)methylsulfanyl]methylidene]azanium (PubChem CID 1419904) has the molecular formula C10H18N7S+ and a molecular weight of 268.37 g/mol. Its IUPAC name is [amino-[(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)methylsulfanyl]methylidene]azanium.
| Compound Name | [amino-[(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)methylsulfanyl]methylidene]azanium |
|---|---|
| PubChem CID | 1419904 |
| Molecular Formula | C10H18N7S+ |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | [amino-[(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)methylsulfanyl]methylidene]azanium |
| SMILES | NC(=[NH2+])SCc1nc(N)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C10H17N7S/c11-8(12)18-6-7-14-9(13)16-10(15-7)17-4-2-1-3-5-17/h1-6H2,(H3,11,12)(H2,13,14,15,16)/p+1 |
| InChIKey | KGIAZRLDNRGJQF-UHFFFAOYSA-O |
| XLogP | -1.25 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|