C15H19N5O2S2 — CID 101077299
4-(benzenesulfonylsulfanylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 101077299) has the molecular formula C15H19N5O2S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 4-(benzenesulfonylsulfanylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(benzenesulfonylsulfanylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 101077299 |
| Molecular Formula | C15H19N5O2S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-(benzenesulfonylsulfanylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(CSS(=O)(=O)c2ccccc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C15H19N5O2S2/c16-14-17-13(18-15(19-14)20-9-5-2-6-10-20)11-23-24(21,22)12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11H2,(H2,16,17,18,19) |
| InChIKey | GFYKKHODICSGGJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|