C33H54O5 — CID 142000554
acetic acid;(11S,17S)-3-(methoxymethoxy)-4,4,10,13-tetramethyl-17-(5-methyl-4-methylidenehexyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-11-ol (PubChem CID 142000554) has the molecular formula C33H54O5 and a molecular weight of 530.79 g/mol. Its IUPAC name is acetic acid;(11S,17S)-3-(methoxymethoxy)-4,4,10,13-tetramethyl-17-(5-methyl-4-methylidenehexyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-11-ol.
| Compound Name | acetic acid;(11S,17S)-3-(methoxymethoxy)-4,4,10,13-tetramethyl-17-(5-methyl-4-methylidenehexyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 142000554 |
| Molecular Formula | C33H54O5 |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 530.40 |
| IUPAC Name | acetic acid;(11S,17S)-3-(methoxymethoxy)-4,4,10,13-tetramethyl-17-(5-methyl-4-methylidenehexyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-11-ol |
| SMILES | C=C(CCC[C@H]1CC=C2C3=C([C@@H](O)CC21C)C1(C)CCC(OCOC)C(C)(C)C1CC3)C(C)C.CC(=O)O |
| InChI | InChI=1S/C31H50O3.C2H4O2/c1-20(2)21(3)10-9-11-22-12-14-24-23-13-15-26-29(4,5)27(34-19-33-8)16-17-30(26,6)28(23)25(32)18-31(22,24)7;1-2(3)4/h14,20,22,25-27,32H,3,9-13,15-19H2,1-2,4-8H3;1H3,(H,3,4)/t22-,25-,26?,27?,30?,31?;/m0./s1 |
| InChIKey | FTWCUSXEQDXVAL-WSJPOLGPSA-N |
| XLogP | 7.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|