C20H15F3N2O2 — CID 142003466
(4-methanimidoylnaphthalen-1-yl)methyl N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 142003466) has the molecular formula C20H15F3N2O2 and a molecular weight of 372.35 g/mol. Its IUPAC name is (4-methanimidoylnaphthalen-1-yl)methyl N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | (4-methanimidoylnaphthalen-1-yl)methyl N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 142003466 |
| Molecular Formula | C20H15F3N2O2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (4-methanimidoylnaphthalen-1-yl)methyl N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | [H]/N=C/c1ccc(COC(=O)Nc2cccc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C20H15F3N2O2/c21-20(22,23)15-4-3-5-16(10-15)25-19(26)27-12-14-9-8-13(11-24)17-6-1-2-7-18(14)17/h1-11,24H,12H2,(H,25,26)/b24-11+ |
| InChIKey | GCVOPFYTDLSCEQ-BHGWPJFGSA-N |
| XLogP | 5.60 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|