C32H36F3N3O2 — CID 142004762
N-[1-[4-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]butyl]piperidin-4-yl]benzamide (PubChem CID 142004762) has the molecular formula C32H36F3N3O2 and a molecular weight of 551.65 g/mol. Its IUPAC name is N-[1-[4-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]butyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[4-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]butyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 142004762 |
| Molecular Formula | C32H36F3N3O2 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | N-[1-[4-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]butyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1)c1ccccc1 |
| InChI | InChI=1S/C32H36F3N3O2/c33-32(34,35)22-36-30(40)31(27-14-6-4-12-25(27)26-13-5-7-15-28(26)31)18-8-9-19-38-20-16-24(17-21-38)37-29(39)23-10-2-1-3-11-23/h1-7,10-15,24,30,36,40H,8-9,16-22H2,(H,37,39) |
| InChIKey | KYBPVDMORXFPAO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|