C20H18N2OS — CID 14200915
2-methyl-5,6-bis(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-one (PubChem CID 14200915) has the molecular formula C20H18N2OS and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-methyl-5,6-bis(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-one.
| Compound Name | 2-methyl-5,6-bis(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-one |
|---|---|
| PubChem CID | 14200915 |
| Molecular Formula | C20H18N2OS |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-methyl-5,6-bis(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-one |
| SMILES | Cc1ccc(-c2nc3n(c2-c2ccc(C)cc2)C(=O)C(C)S3)cc1 |
| InChI | InChI=1S/C20H18N2OS/c1-12-4-8-15(9-5-12)17-18(16-10-6-13(2)7-11-16)22-19(23)14(3)24-20(22)21-17/h4-11,14H,1-3H3 |
| InChIKey | KKXXYFUKNILVOK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |