C23H35Cl2N3OS — CID 14201523
N-butyl-N-[3-[4-(5-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenoxy]propyl]butan-1-amine;dihydrochloride (PubChem CID 14201523) has the molecular formula C23H35Cl2N3OS and a molecular weight of 472.53 g/mol. Its IUPAC name is N-butyl-N-[3-[4-(5-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenoxy]propyl]butan-1-amine;dihydrochloride.
| Compound Name | N-butyl-N-[3-[4-(5-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenoxy]propyl]butan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 14201523 |
| Molecular Formula | C23H35Cl2N3OS |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-butyl-N-[3-[4-(5-methylimidazo[2,1-b][1,3]thiazol-6-yl)phenoxy]propyl]butan-1-amine;dihydrochloride |
| SMILES | CCCCN(CCCC)CCCOc1ccc(-c2nc3sccn3c2C)cc1.Cl.Cl |
| InChI | InChI=1S/C23H33N3OS.2ClH/c1-4-6-13-25(14-7-5-2)15-8-17-27-21-11-9-20(10-12-21)22-19(3)26-16-18-28-23(26)24-22;;/h9-12,16,18H,4-8,13-15,17H2,1-3H3;2*1H |
| InChIKey | OAKZSXWOYAAVLG-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|