C23H17NS — CID 142015857
2',7'-dimethylspiro[3-thia-11-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-fluorene] (PubChem CID 142015857) has the molecular formula C23H17NS and a molecular weight of 339.46 g/mol. Its IUPAC name is 2',7'-dimethylspiro[3-thia-11-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-fluorene].
| Compound Name | 2',7'-dimethylspiro[3-thia-11-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-fluorene] |
|---|---|
| PubChem CID | 142015857 |
| Molecular Formula | C23H17NS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2',7'-dimethylspiro[3-thia-11-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-fluorene] |
| SMILES | Cc1ccc2c(c1)C1(c3cc(C)ccc3-2)c2cc[nH]c2-c2sccc21 |
| InChI | InChI=1S/C23H17NS/c1-13-3-5-15-16-6-4-14(2)12-20(16)23(19(15)11-13)17-7-9-24-21(17)22-18(23)8-10-25-22/h3-12,24H,1-2H3 |
| InChIKey | VWPCKPXIIDSCGT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |