C23H23N7O2 — CID 142016676
4-[[2-(1-methylindol-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N'-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 142016676) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is 4-[[2-(1-methylindol-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N'-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | 4-[[2-(1-methylindol-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N'-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 142016676 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 4-[[2-(1-methylindol-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N'-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | Cn1c(C2=NC(=CN3CCN(/C(N)=N/c4ccccn4)CC3)C(=O)O2)cc2ccccc21 |
| InChI | InChI=1S/C23H23N7O2/c1-28-18-7-3-2-6-16(18)14-19(28)21-26-17(22(31)32-21)15-29-10-12-30(13-11-29)23(24)27-20-8-4-5-9-25-20/h2-9,14-15H,10-13H2,1H3,(H2,24,25,27) |
| InChIKey | PMZICVFWOIERLW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|