C32H29N3O — CID 142019656
(E)-1-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]phenyl]-N-(methylideneamino)ethanimine;ethane (PubChem CID 142019656) has the molecular formula C32H29N3O and a molecular weight of 471.60 g/mol. Its IUPAC name is (E)-1-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]phenyl]-N-(methylideneamino)ethanimine;ethane.
| Compound Name | (E)-1-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]phenyl]-N-(methylideneamino)ethanimine;ethane |
|---|---|
| PubChem CID | 142019656 |
| Molecular Formula | C32H29N3O |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | (E)-1-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]phenyl]-N-(methylideneamino)ethanimine;ethane |
| SMILES | C=N/N=C(\C)c1cccc(-c2ccccc2-c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1.CC |
| InChI | InChI=1S/C30H23N3O.C2H6/c1-21(33-31-2)24-16-11-17-25(20-24)26-18-9-10-19-27(26)30-32-28(22-12-5-3-6-13-22)29(34-30)23-14-7-4-8-15-23;1-2/h3-20H,2H2,1H3;1-2H3/b33-21+; |
| InChIKey | UNHBWYSGVPOSPL-KOCUTIIDSA-N |
| XLogP | 8.79 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|