C13H21N — CID 142020170
ethane;2-ethyl-6-methyl-3a,7a-dihydro-3H-indole (PubChem CID 142020170) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is ethane;2-ethyl-6-methyl-3a,7a-dihydro-3H-indole.
| Compound Name | ethane;2-ethyl-6-methyl-3a,7a-dihydro-3H-indole |
|---|---|
| PubChem CID | 142020170 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | ethane;2-ethyl-6-methyl-3a,7a-dihydro-3H-indole |
| SMILES | CC.CCC1=NC2C=C(C)C=CC2C1 |
| InChI | InChI=1S/C11H15N.C2H6/c1-3-10-7-9-5-4-8(2)6-11(9)12-10;1-2/h4-6,9,11H,3,7H2,1-2H3;1-2H3 |
| InChIKey | VIYQWVLLNKMBID-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |