C20H24N2O4S2 — CID 142028138
N-hydroxy-2,3-dimethoxy-6-(4-phenylsulfanylpiperidin-1-yl)sulfanylbenzamide (PubChem CID 142028138) has the molecular formula C20H24N2O4S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-hydroxy-2,3-dimethoxy-6-(4-phenylsulfanylpiperidin-1-yl)sulfanylbenzamide.
| Compound Name | N-hydroxy-2,3-dimethoxy-6-(4-phenylsulfanylpiperidin-1-yl)sulfanylbenzamide |
|---|---|
| PubChem CID | 142028138 |
| Molecular Formula | C20H24N2O4S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-hydroxy-2,3-dimethoxy-6-(4-phenylsulfanylpiperidin-1-yl)sulfanylbenzamide |
| SMILES | COc1ccc(SN2CCC(Sc3ccccc3)CC2)c(C(=O)NO)c1OC |
| InChI | InChI=1S/C20H24N2O4S2/c1-25-16-8-9-17(18(19(16)26-2)20(23)21-24)28-22-12-10-15(11-13-22)27-14-6-4-3-5-7-14/h3-9,15,24H,10-13H2,1-2H3,(H,21,23) |
| InChIKey | BGOJMKHWLWUUPX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|