C14H22N2O4S — CID 142096155
6-[ethyl(propyl)amino]sulfanyl-N-hydroxy-2,3-dimethoxybenzamide (PubChem CID 142096155) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 6-[ethyl(propyl)amino]sulfanyl-N-hydroxy-2,3-dimethoxybenzamide.
| Compound Name | 6-[ethyl(propyl)amino]sulfanyl-N-hydroxy-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 142096155 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 6-[ethyl(propyl)amino]sulfanyl-N-hydroxy-2,3-dimethoxybenzamide |
| SMILES | CCCN(CC)Sc1ccc(OC)c(OC)c1C(=O)NO |
| InChI | InChI=1S/C14H22N2O4S/c1-5-9-16(6-2)21-11-8-7-10(19-3)13(20-4)12(11)14(17)15-18/h7-8,18H,5-6,9H2,1-4H3,(H,15,17) |
| InChIKey | HTULPRWIVCKCEK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|