C23H29F3N2O6S — CID 142096237
N-hydroxy-2,3-dimethoxy-6-[propyl-[3-[4-(trifluoromethoxy)phenoxy]butyl]amino]sulfanylbenzamide (PubChem CID 142096237) has the molecular formula C23H29F3N2O6S and a molecular weight of 518.55 g/mol. Its IUPAC name is N-hydroxy-2,3-dimethoxy-6-[propyl-[3-[4-(trifluoromethoxy)phenoxy]butyl]amino]sulfanylbenzamide.
| Compound Name | N-hydroxy-2,3-dimethoxy-6-[propyl-[3-[4-(trifluoromethoxy)phenoxy]butyl]amino]sulfanylbenzamide |
|---|---|
| PubChem CID | 142096237 |
| Molecular Formula | C23H29F3N2O6S |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | N-hydroxy-2,3-dimethoxy-6-[propyl-[3-[4-(trifluoromethoxy)phenoxy]butyl]amino]sulfanylbenzamide |
| SMILES | CCCN(CCC(C)Oc1ccc(OC(F)(F)F)cc1)Sc1ccc(OC)c(OC)c1C(=O)NO |
| InChI | InChI=1S/C23H29F3N2O6S/c1-5-13-28(35-19-11-10-18(31-3)21(32-4)20(19)22(29)27-30)14-12-15(2)33-16-6-8-17(9-7-16)34-23(24,25)26/h6-11,15,30H,5,12-14H2,1-4H3,(H,27,29) |
| InChIKey | PDZISPKSVSVLJW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|