C15H19NO2S2 — CID 142038788
ethane;4-phenyl-5-sulfanyl-6-(sulfanylmethyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 142038788) has the molecular formula C15H19NO2S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is ethane;4-phenyl-5-sulfanyl-6-(sulfanylmethyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | ethane;4-phenyl-5-sulfanyl-6-(sulfanylmethyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 142038788 |
| Molecular Formula | C15H19NO2S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | ethane;4-phenyl-5-sulfanyl-6-(sulfanylmethyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC.O=C(O)C1=CNC(CS)=C(S)C1c1ccccc1 |
| InChI | InChI=1S/C13H13NO2S2.C2H6/c15-13(16)9-6-14-10(7-17)12(18)11(9)8-4-2-1-3-5-8;1-2/h1-6,11,14,17-18H,7H2,(H,15,16);1-2H3 |
| InChIKey | RGYJEWDGSGPNBN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|