C38H29NO2 — CID 98755392
(3R,6R)-7-benzoyl-3,4,5,6-tetraphenyl-3,6-dihydro-1H-azocin-2-one (PubChem CID 98755392) has the molecular formula C38H29NO2 and a molecular weight of 531.66 g/mol. Its IUPAC name is (3R,6R)-7-benzoyl-3,4,5,6-tetraphenyl-3,6-dihydro-1H-azocin-2-one.
| Compound Name | (3R,6R)-7-benzoyl-3,4,5,6-tetraphenyl-3,6-dihydro-1H-azocin-2-one |
|---|---|
| PubChem CID | 98755392 |
| Molecular Formula | C38H29NO2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | (3R,6R)-7-benzoyl-3,4,5,6-tetraphenyl-3,6-dihydro-1H-azocin-2-one |
| SMILES | O=C(C1=CNC(=O)[C@H](c2ccccc2)C(c2ccccc2)=C(c2ccccc2)[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H29NO2/c40-37(31-24-14-5-15-25-31)32-26-39-38(41)36(30-22-12-4-13-23-30)35(29-20-10-3-11-21-29)34(28-18-8-2-9-19-28)33(32)27-16-6-1-7-17-27/h1-26,33,36H,(H,39,41)/t33-,36+/m0/s1 |
| InChIKey | BTFFKKISHQZFNP-MSEJLTFDSA-N |
| XLogP | 8.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|