C25H34N6O4S — CID 142038998
N-(3-benzylsulfanyl-2-oxopropyl)-2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxo-5-propan-2-ylpyrazin-1-yl]butanamide (PubChem CID 142038998) has the molecular formula C25H34N6O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is N-(3-benzylsulfanyl-2-oxopropyl)-2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxo-5-propan-2-ylpyrazin-1-yl]butanamide.
| Compound Name | N-(3-benzylsulfanyl-2-oxopropyl)-2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxo-5-propan-2-ylpyrazin-1-yl]butanamide |
|---|---|
| PubChem CID | 142038998 |
| Molecular Formula | C25H34N6O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | N-(3-benzylsulfanyl-2-oxopropyl)-2-[3-[[(2Z)-2-hydroxyimino-3-iminobutyl]amino]-2-oxo-5-propan-2-ylpyrazin-1-yl]butanamide |
| SMILES | [H]/N=C(C)/C(CNc1nc(C(C)C)cn(C(CC)C(=O)NCC(=O)CSCc2ccccc2)c1=O)=N\O |
| InChI | InChI=1S/C25H34N6O4S/c1-5-22(24(33)28-11-19(32)15-36-14-18-9-7-6-8-10-18)31-13-21(16(2)3)29-23(25(31)34)27-12-20(30-35)17(4)26/h6-10,13,16,22,26,35H,5,11-12,14-15H2,1-4H3,(H,27,29)(H,28,33)/b26-17+,30-20- |
| InChIKey | BTMVJTHDWBPQDO-LWKLCIDISA-N |
| XLogP | 3.22 |
| TPSA | 149.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|