C25H32N6O7S — CID 88938478
4-[[4-[1-[(4-benzylsulfanyl-1-carboxy-3-oxobutan-2-yl)amino]-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]-3-imino-N-methoxybutan-2-imine oxide (PubChem CID 88938478) has the molecular formula C25H32N6O7S and a molecular weight of 560.63 g/mol. Its IUPAC name is 4-[[4-[1-[(4-benzylsulfanyl-1-carboxy-3-oxobutan-2-yl)amino]-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]-3-imino-N-methoxybutan-2-imine oxide.
| Compound Name | 4-[[4-[1-[(4-benzylsulfanyl-1-carboxy-3-oxobutan-2-yl)amino]-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]-3-imino-N-methoxybutan-2-imine oxide |
|---|---|
| PubChem CID | 88938478 |
| Molecular Formula | C25H32N6O7S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 4-[[4-[1-[(4-benzylsulfanyl-1-carboxy-3-oxobutan-2-yl)amino]-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]-3-imino-N-methoxybutan-2-imine oxide |
| SMILES | [H]/N=C(CNc1nccn(C(CC)C(=O)NC(CC(=O)O)C(=O)CSCc2ccccc2)c1=O)\C(C)=[N+](/[O-])OC |
| InChI | InChI=1S/C25H32N6O7S/c1-4-20(30-11-10-27-23(25(30)36)28-13-18(26)16(2)31(37)38-3)24(35)29-19(12-22(33)34)21(32)15-39-14-17-8-6-5-7-9-17/h5-11,19-20,26H,4,12-15H2,1-3H3,(H,27,28)(H,29,35)(H,33,34)/b26-18-,31-16+ |
| InChIKey | LQOOOGDIBXZYDY-WREWXBHLSA-N |
| XLogP | 1.62 |
| TPSA | 189.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|