About formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol
formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol (PubChem CID 142054431) has the molecular formula C22H47NO3Sn
and a molecular weight of 492.33 g/mol. Its IUPAC name is formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol.
Molecular Properties
| Compound Name | formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol |
| PubChem CID | 142054431 |
| Molecular Formula | C22H47NO3Sn |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol |
| SMILES | C=O.CCCC[Sn](CCCC)(CCCC)C1(O)CCN(OC(C)(C)C)CC1 |
| InChI | InChI=1S/C9H18NO2.3C4H9.CH2O.Sn/c1-9(2,3)12-10-6-4-8(11)5-7-10;3*1-3-4-2;1-2;/h11H,4-7H2,1-3H3;3*1,3-4H2,2H3;1H2; |
| InChIKey | LSPPLCYRKJUJJC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol?
The IUPAC name of formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol (CID 142054431) is formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol.
What is the SMILES notation for formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol?
The canonical SMILES for formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol is C=O.CCCC[Sn](CCCC)(CCCC)C1(O)CCN(OC(C)(C)C)CC1.
What is the InChIKey of formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol?
The InChIKey is LSPPLCYRKJUJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO2.3C4H9.CH2O.Sn/c1-9(2,3)12-10-6-4-8(11)5-7-10;3*1-3-4-2;1-2;/h11H,4-7H2,1-3H3;3*1,3-4H2,2H3;1H2;.
What are the key properties of formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol?
formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol has a molecular weight of 492.33 g/mol, XLogP of 5.75, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;1-[(2-methylpropan-2-yl)oxy]-4-tributylstannylpiperidin-4-ol is sourced from PubChem (CID 142054431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).