C11H11ClN2 — CID 142064766
5-chloro-1-methyl-2-methylidene-3H-1,4-benzodiazepine (PubChem CID 142064766) has the molecular formula C11H11ClN2 and a molecular weight of 206.68 g/mol. Its IUPAC name is 5-chloro-1-methyl-2-methylidene-3H-1,4-benzodiazepine.
| Compound Name | 5-chloro-1-methyl-2-methylidene-3H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 142064766 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5-chloro-1-methyl-2-methylidene-3H-1,4-benzodiazepine |
| SMILES | C=C1CN=C(Cl)c2ccccc2N1C |
| InChI | InChI=1S/C11H11ClN2/c1-8-7-13-11(12)9-5-3-4-6-10(9)14(8)2/h3-6H,1,7H2,2H3 |
| InChIKey | VFPWGNDIRLYULY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |