C19H27ClN8O4 — CID 142066065
1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]-N-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]pyrrole-2-carboxamide;hydrochloride (PubChem CID 142066065) has the molecular formula C19H27ClN8O4 and a molecular weight of 466.93 g/mol. Its IUPAC name is 1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]-N-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]pyrrole-2-carboxamide;hydrochloride.
| Compound Name | 1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]-N-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 142066065 |
| Molecular Formula | C19H27ClN8O4 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]-N-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]pyrrole-2-carboxamide;hydrochloride |
| SMILES | CC(CNC(=O)c1cc(NC(=O)c2cc([N+](=O)[O-])cn2C)cn1C)NC1=NCCCN1.Cl |
| InChI | InChI=1S/C19H26N8O4.ClH/c1-12(23-19-20-5-4-6-21-19)9-22-17(28)15-7-13(10-25(15)2)24-18(29)16-8-14(27(30)31)11-26(16)3;/h7-8,10-12H,4-6,9H2,1-3H3,(H,22,28)(H,24,29)(H2,20,21,23);1H |
| InChIKey | BWTBDUDAEODZRD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|