C20H27ClN2OS — CID 142072316
N-(4-butylphenyl)sulfanyl-4-chloro-3-[2-(dimethylamino)ethoxy]aniline (PubChem CID 142072316) has the molecular formula C20H27ClN2OS and a molecular weight of 378.97 g/mol. Its IUPAC name is N-(4-butylphenyl)sulfanyl-4-chloro-3-[2-(dimethylamino)ethoxy]aniline.
| Compound Name | N-(4-butylphenyl)sulfanyl-4-chloro-3-[2-(dimethylamino)ethoxy]aniline |
|---|---|
| PubChem CID | 142072316 |
| Molecular Formula | C20H27ClN2OS |
| Molecular Weight | 378.97 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-(4-butylphenyl)sulfanyl-4-chloro-3-[2-(dimethylamino)ethoxy]aniline |
| SMILES | CCCCc1ccc(SNc2ccc(Cl)c(OCCN(C)C)c2)cc1 |
| InChI | InChI=1S/C20H27ClN2OS/c1-4-5-6-16-7-10-18(11-8-16)25-22-17-9-12-19(21)20(15-17)24-14-13-23(2)3/h7-12,15,22H,4-6,13-14H2,1-3H3 |
| InChIKey | VVQJAUMAAHDJLO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.97 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|