C17H22ClFN2OS — CID 142072355
4-chloro-3-[2-(dimethylamino)ethoxy]-N-phenylsulfanylaniline;fluoromethane (PubChem CID 142072355) has the molecular formula C17H22ClFN2OS and a molecular weight of 356.89 g/mol. Its IUPAC name is 4-chloro-3-[2-(dimethylamino)ethoxy]-N-phenylsulfanylaniline;fluoromethane.
| Compound Name | 4-chloro-3-[2-(dimethylamino)ethoxy]-N-phenylsulfanylaniline;fluoromethane |
|---|---|
| PubChem CID | 142072355 |
| Molecular Formula | C17H22ClFN2OS |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 4-chloro-3-[2-(dimethylamino)ethoxy]-N-phenylsulfanylaniline;fluoromethane |
| SMILES | CF.CN(C)CCOc1cc(NSc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C16H19ClN2OS.CH3F/c1-19(2)10-11-20-16-12-13(8-9-15(16)17)18-21-14-6-4-3-5-7-14;1-2/h3-9,12,18H,10-11H2,1-2H3;1H3 |
| InChIKey | UUAZGEDHFPFPMT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|