C8H12N2 — CID 142082779
(2E)-2-prop-1-en-2-ylpenta-2,4-dienimidamide (PubChem CID 142082779) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (2E)-2-prop-1-en-2-ylpenta-2,4-dienimidamide.
| Compound Name | (2E)-2-prop-1-en-2-ylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 142082779 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (2E)-2-prop-1-en-2-ylpenta-2,4-dienimidamide |
| SMILES | [H]/N=C(N)/C(=C/C=C)C(=C)C |
| InChI | InChI=1S/C8H12N2/c1-4-5-7(6(2)3)8(9)10/h4-5H,1-2H2,3H3,(H3,9,10)/b7-5+ |
| InChIKey | ONAKHQDGMXQENK-FNORWQNLSA-N |
| XLogP | 1.61 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|