C23H30ClN5O3 — CID 142083466
but-3-enimidamide;N-(5-chloro-2-pyridinyl)-5-hydroxy-2-[[(E)-pent-2-enoyl]amino]benzamide;ethane (PubChem CID 142083466) has the molecular formula C23H30ClN5O3 and a molecular weight of 459.98 g/mol. Its IUPAC name is but-3-enimidamide;N-(5-chloro-2-pyridinyl)-5-hydroxy-2-[[(E)-pent-2-enoyl]amino]benzamide;ethane.
| Compound Name | but-3-enimidamide;N-(5-chloro-2-pyridinyl)-5-hydroxy-2-[[(E)-pent-2-enoyl]amino]benzamide;ethane |
|---|---|
| PubChem CID | 142083466 |
| Molecular Formula | C23H30ClN5O3 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | but-3-enimidamide;N-(5-chloro-2-pyridinyl)-5-hydroxy-2-[[(E)-pent-2-enoyl]amino]benzamide;ethane |
| SMILES | CC.CC/C=C/C(=O)Nc1ccc(O)cc1C(=O)Nc1ccc(Cl)cn1.[H]/N=C(/N)CC=C |
| InChI | InChI=1S/C17H16ClN3O3.C4H8N2.C2H6/c1-2-3-4-16(23)20-14-7-6-12(22)9-13(14)17(24)21-15-8-5-11(18)10-19-15;1-2-3-4(5)6;1-2/h3-10,22H,2H2,1H3,(H,20,23)(H,19,21,24);2H,1,3H2,(H3,5,6);1-2H3/b4-3+;; |
| InChIKey | YPBTXISTUKYTQK-CZEFNJPISA-N |
| XLogP | 5.12 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|