C10H7F5N2O — CID 142087285
N-[1-[2,3-difluoro-6-(methylamino)phenyl]-2,2,2-trifluoroethylidene]formamide (PubChem CID 142087285) has the molecular formula C10H7F5N2O and a molecular weight of 266.17 g/mol. Its IUPAC name is N-[1-[2,3-difluoro-6-(methylamino)phenyl]-2,2,2-trifluoroethylidene]formamide.
| Compound Name | N-[1-[2,3-difluoro-6-(methylamino)phenyl]-2,2,2-trifluoroethylidene]formamide |
|---|---|
| PubChem CID | 142087285 |
| Molecular Formula | C10H7F5N2O |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | N-[1-[2,3-difluoro-6-(methylamino)phenyl]-2,2,2-trifluoroethylidene]formamide |
| SMILES | CNc1ccc(F)c(F)c1/C(=N/C=O)C(F)(F)F |
| InChI | InChI=1S/C10H7F5N2O/c1-16-6-3-2-5(11)8(12)7(6)9(17-4-18)10(13,14)15/h2-4,16H,1H3/b17-9- |
| InChIKey | PNWYTRBMLBFDAL-MFOYZWKCSA-N |
| XLogP | 2.51 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|