C8H20N2O — CID 142087825
ethane;1-hydroxy-4-methyl-1,4-diazepane (PubChem CID 142087825) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is ethane;1-hydroxy-4-methyl-1,4-diazepane.
| Compound Name | ethane;1-hydroxy-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 142087825 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | ethane;1-hydroxy-4-methyl-1,4-diazepane |
| SMILES | CC.CN1CCCN(O)CC1 |
| InChI | InChI=1S/C6H14N2O.C2H6/c1-7-3-2-4-8(9)6-5-7;1-2/h9H,2-6H2,1H3;1-2H3 |
| InChIKey | BCEMKFSDLWIWIB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |