C41H63N — CID 142094968
3-[2-ethyl-3-[[5-methyl-6-(5-methylhexyl)-15-pentacyclo[8.7.0.01,13.02,10.05,9]heptadec-12-enyl]methyl]but-3-enyl]-2,4,6-trimethylaniline (PubChem CID 142094968) has the molecular formula C41H63N and a molecular weight of 569.96 g/mol. Its IUPAC name is 3-[2-ethyl-3-[[5-methyl-6-(5-methylhexyl)-15-pentacyclo[8.7.0.01,13.02,10.05,9]heptadec-12-enyl]methyl]but-3-enyl]-2,4,6-trimethylaniline.
| Compound Name | 3-[2-ethyl-3-[[5-methyl-6-(5-methylhexyl)-15-pentacyclo[8.7.0.01,13.02,10.05,9]heptadec-12-enyl]methyl]but-3-enyl]-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 142094968 |
| Molecular Formula | C41H63N |
| Molecular Weight | 569.96 g/mol |
| Exact Mass | 569.50 |
| IUPAC Name | 3-[2-ethyl-3-[[5-methyl-6-(5-methylhexyl)-15-pentacyclo[8.7.0.01,13.02,10.05,9]heptadec-12-enyl]methyl]but-3-enyl]-2,4,6-trimethylaniline |
| SMILES | C=C(CC1CCC23C(=CCC24C2CCC(CCCCC(C)C)C2(C)CCC34)C1)C(CC)Cc1c(C)cc(C)c(N)c1C |
| InChI | InChI=1S/C41H63N/c1-9-32(25-35-28(5)22-29(6)38(42)30(35)7)27(4)23-31-16-20-40-34(24-31)17-21-41(40)36-15-14-33(13-11-10-12-26(2)3)39(36,8)19-18-37(40)41/h17,22,26,31-33,36-37H,4,9-16,18-21,23-25,42H2,1-3,5-8H3 |
| InChIKey | CMNIYMUDZWBBHC-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.96 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|