C33H51N3O2 — CID 171517658
[(8R,10R,13R)-8-amino-10,13-dimethyl-17-(5-methylhexyl)-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4,4-dicyanopentanoate (PubChem CID 171517658) has the molecular formula C33H51N3O2 and a molecular weight of 521.79 g/mol. Its IUPAC name is [(8R,10R,13R)-8-amino-10,13-dimethyl-17-(5-methylhexyl)-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4,4-dicyanopentanoate.
| Compound Name | [(8R,10R,13R)-8-amino-10,13-dimethyl-17-(5-methylhexyl)-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4,4-dicyanopentanoate |
|---|---|
| PubChem CID | 171517658 |
| Molecular Formula | C33H51N3O2 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.40 |
| IUPAC Name | [(8R,10R,13R)-8-amino-10,13-dimethyl-17-(5-methylhexyl)-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4,4-dicyanopentanoate |
| SMILES | CC(C)CCCCC1CCC2[C@]1(C)CCC1[C@@]2(N)CC=C2CC(OC(=O)CCC(C)(C#N)C#N)CC[C@@]21C |
| InChI | InChI=1S/C33H51N3O2/c1-23(2)8-6-7-9-24-10-11-27-31(24,4)18-14-28-32(5)17-13-26(20-25(32)12-19-33(27,28)36)38-29(37)15-16-30(3,21-34)22-35/h12,23-24,26-28H,6-11,13-20,36H2,1-5H3/t24?,26?,27?,28?,31-,32+,33-/m1/s1 |
| InChIKey | LSXRCOMLUMIQNH-FRDYVBEGSA-N |
| XLogP | 7.61 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|