C21H25N2OS+ — CID 142108246
(2-amino-1-cyclohepta-1,3,6-trien-1-yl-2-oxoethyl)-(naphthalen-2-ylmethyl)azanium;methanethiol (PubChem CID 142108246) has the molecular formula C21H25N2OS+ and a molecular weight of 353.51 g/mol. Its IUPAC name is (2-amino-1-cyclohepta-1,3,6-trien-1-yl-2-oxoethyl)-(naphthalen-2-ylmethyl)azanium;methanethiol.
| Compound Name | (2-amino-1-cyclohepta-1,3,6-trien-1-yl-2-oxoethyl)-(naphthalen-2-ylmethyl)azanium;methanethiol |
|---|---|
| PubChem CID | 142108246 |
| Molecular Formula | C21H25N2OS+ |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (2-amino-1-cyclohepta-1,3,6-trien-1-yl-2-oxoethyl)-(naphthalen-2-ylmethyl)azanium;methanethiol |
| SMILES | CS.NC(=O)C([NH2+]Cc1ccc2ccccc2c1)C1=CC=CCC=C1 |
| InChI | InChI=1S/C20H20N2O.CH4S/c21-20(23)19(17-8-3-1-2-4-9-17)22-14-15-11-12-16-7-5-6-10-18(16)13-15;1-2/h1,3-13,19,22H,2,14H2,(H2,21,23);2H,1H3/p+1 |
| InChIKey | ADWAZHIKOWWLMK-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|