C20H21N2O+ — CID 23548784
[2-(methylamino)-2-oxo-1-phenylethyl]-(naphthalen-2-ylmethyl)azanium (PubChem CID 23548784) has the molecular formula C20H21N2O+ and a molecular weight of 305.40 g/mol. Its IUPAC name is [2-(methylamino)-2-oxo-1-phenylethyl]-(naphthalen-2-ylmethyl)azanium.
| Compound Name | [2-(methylamino)-2-oxo-1-phenylethyl]-(naphthalen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 23548784 |
| Molecular Formula | C20H21N2O+ |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | [2-(methylamino)-2-oxo-1-phenylethyl]-(naphthalen-2-ylmethyl)azanium |
| SMILES | CNC(=O)C([NH2+]Cc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O/c1-21-20(23)19(17-8-3-2-4-9-17)22-14-15-11-12-16-7-5-6-10-18(16)13-15/h2-13,19,22H,14H2,1H3,(H,21,23)/p+1 |
| InChIKey | HWOSKEQGHVCOOS-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |