C10H9N3S — CID 142111809
(1E)-3-imidazo[1,2-a]pyrazin-3-ylbuta-1,3-diene-1-thiol (PubChem CID 142111809) has the molecular formula C10H9N3S and a molecular weight of 203.27 g/mol. Its IUPAC name is (1E)-3-imidazo[1,2-a]pyrazin-3-ylbuta-1,3-diene-1-thiol.
| Compound Name | (1E)-3-imidazo[1,2-a]pyrazin-3-ylbuta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 142111809 |
| Molecular Formula | C10H9N3S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | (1E)-3-imidazo[1,2-a]pyrazin-3-ylbuta-1,3-diene-1-thiol |
| SMILES | C=C(/C=C/S)c1cnc2cnccn12 |
| InChI | InChI=1S/C10H9N3S/c1-8(2-5-14)9-6-12-10-7-11-3-4-13(9)10/h2-7,14H,1H2/b5-2+ |
| InChIKey | UXFSQOLEHHEYQN-GORDUTHDSA-N |
| XLogP | 2.19 |
| TPSA | 30.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|