C18H36N2 — CID 142112970
ethane;N-ethyl-1-methyl-4-[(3Z)-penta-1,3-dien-2-yl]-3,6-dihydro-2H-pyridin-5-amine;propane (PubChem CID 142112970) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is ethane;N-ethyl-1-methyl-4-[(3Z)-penta-1,3-dien-2-yl]-3,6-dihydro-2H-pyridin-5-amine;propane.
| Compound Name | ethane;N-ethyl-1-methyl-4-[(3Z)-penta-1,3-dien-2-yl]-3,6-dihydro-2H-pyridin-5-amine;propane |
|---|---|
| PubChem CID | 142112970 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | ethane;N-ethyl-1-methyl-4-[(3Z)-penta-1,3-dien-2-yl]-3,6-dihydro-2H-pyridin-5-amine;propane |
| SMILES | C=C(/C=C\C)C1=C(NCC)CN(C)CC1.CC.CCC |
| InChI | InChI=1S/C13H22N2.C3H8.C2H6/c1-5-7-11(3)12-8-9-15(4)10-13(12)14-6-2;1-3-2;1-2/h5,7,14H,3,6,8-10H2,1-2,4H3;3H2,1-2H3;1-2H3/b7-5-;; |
| InChIKey | XYLUNMNGBGHOSJ-MWKZNRQPSA-N |
| XLogP | 4.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|