C13H25NS — CID 142113145
(3Z,5Z)-hepta-1,3,5-triene;N-methylethanethioamide;propane (PubChem CID 142113145) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is (3Z,5Z)-hepta-1,3,5-triene;N-methylethanethioamide;propane.
| Compound Name | (3Z,5Z)-hepta-1,3,5-triene;N-methylethanethioamide;propane |
|---|---|
| PubChem CID | 142113145 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (3Z,5Z)-hepta-1,3,5-triene;N-methylethanethioamide;propane |
| SMILES | C=C/C=C\C=C/C.CCC.CNC(C)=S |
| InChI | InChI=1S/C7H10.C3H7NS.C3H8/c1-3-5-7-6-4-2;1-3(5)4-2;1-3-2/h3-7H,1H2,2H3;1-2H3,(H,4,5);3H2,1-2H3/b6-4-,7-5-;; |
| InChIKey | RWTXVHRSQIWZGX-RVMHNBBFSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|