C11H19NS — CID 143198283
N-methylethanethioamide;(3Z,5Z)-2-methylhepta-1,3,5-triene (PubChem CID 143198283) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is N-methylethanethioamide;(3Z,5Z)-2-methylhepta-1,3,5-triene.
| Compound Name | N-methylethanethioamide;(3Z,5Z)-2-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143198283 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-methylethanethioamide;(3Z,5Z)-2-methylhepta-1,3,5-triene |
| SMILES | C=C(C)/C=C\C=C/C.CNC(C)=S |
| InChI | InChI=1S/C8H12.C3H7NS/c1-4-5-6-7-8(2)3;1-3(5)4-2/h4-7H,2H2,1,3H3;1-2H3,(H,4,5)/b5-4-,7-6-; |
| InChIKey | CAMYITITHJGZDC-CYSANHHKSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|