C9H11NS — CID 142205226
N-methylcyclohepta-1,4,6-triene-1-carbothioamide (PubChem CID 142205226) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is N-methylcyclohepta-1,4,6-triene-1-carbothioamide.
| Compound Name | N-methylcyclohepta-1,4,6-triene-1-carbothioamide |
|---|---|
| PubChem CID | 142205226 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | N-methylcyclohepta-1,4,6-triene-1-carbothioamide |
| SMILES | CNC(=S)C1=CCC=CC=C1 |
| InChI | InChI=1S/C9H11NS/c1-10-9(11)8-6-4-2-3-5-7-8/h2-4,6-7H,5H2,1H3,(H,10,11) |
| InChIKey | MVLLDQLPJFXUEX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|