C12H13N3O — CID 142114011
N-[(Z)-2-(1,3-dimethylpyrrolo[2,3-b]pyridin-2-yl)ethenyl]formamide (PubChem CID 142114011) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is N-[(Z)-2-(1,3-dimethylpyrrolo[2,3-b]pyridin-2-yl)ethenyl]formamide.
| Compound Name | N-[(Z)-2-(1,3-dimethylpyrrolo[2,3-b]pyridin-2-yl)ethenyl]formamide |
|---|---|
| PubChem CID | 142114011 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N-[(Z)-2-(1,3-dimethylpyrrolo[2,3-b]pyridin-2-yl)ethenyl]formamide |
| SMILES | Cc1c(/C=C\NC=O)n(C)c2ncccc12 |
| InChI | InChI=1S/C12H13N3O/c1-9-10-4-3-6-14-12(10)15(2)11(9)5-7-13-8-16/h3-8H,1-2H3,(H,13,16)/b7-5- |
| InChIKey | KFHFYYZEBVWIQU-ALCCZGGFSA-N |
| XLogP | 1.60 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|