C15H16N2 — CID 143631634
2-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethylpyrrolo[2,3-b]pyridine (PubChem CID 143631634) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethylpyrrolo[2,3-b]pyridine.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 143631634 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethylpyrrolo[2,3-b]pyridine |
| SMILES | C=C/C=C(\C=C)c1c(C)c2cccnc2n1C |
| InChI | InChI=1S/C15H16N2/c1-5-8-12(6-2)14-11(3)13-9-7-10-16-15(13)17(14)4/h5-10H,1-2H2,3-4H3/b12-8+ |
| InChIKey | UWSXMBXVXKLFDG-XYOKQWHBSA-N |
| XLogP | 3.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|