C17H22N2 — CID 143631633
ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethylpyrrolo[2,3-b]pyridine (PubChem CID 143631633) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethylpyrrolo[2,3-b]pyridine.
| Compound Name | ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 143631633 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethylpyrrolo[2,3-b]pyridine |
| SMILES | C=C/C=C(\C=C)c1c(C)c2cccnc2n1C.CC |
| InChI | InChI=1S/C15H16N2.C2H6/c1-5-8-12(6-2)14-11(3)13-9-7-10-16-15(13)17(14)4;1-2/h5-10H,1-2H2,3-4H3;1-2H3/b12-8+; |
| InChIKey | GGBWRFDAQZQZIE-MXZHIVQLSA-N |
| XLogP | 4.66 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|