C22H20N4O4 — CID 142129681
4-[(7aS)-7a-diazenyl-7-(2-hydroxyethyl)-4-methyl-1,3-dioxo-5,6-dihydro-3aH-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 142129681) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-[(7aS)-7a-diazenyl-7-(2-hydroxyethyl)-4-methyl-1,3-dioxo-5,6-dihydro-3aH-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(7aS)-7a-diazenyl-7-(2-hydroxyethyl)-4-methyl-1,3-dioxo-5,6-dihydro-3aH-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 142129681 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-[(7aS)-7a-diazenyl-7-(2-hydroxyethyl)-4-methyl-1,3-dioxo-5,6-dihydro-3aH-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | [H]/N=N\[C@@]12C(=O)N(c3ccc(C#N)c4ccccc34)C(=O)C1C1(C)CCC2(CCO)O1 |
| InChI | InChI=1S/C22H20N4O4/c1-20-8-9-21(30-20,10-11-27)22(25-24)17(20)18(28)26(19(22)29)16-7-6-13(12-23)14-4-2-3-5-15(14)16/h2-7,17,24,27H,8-11H2,1H3/b25-24-/t17?,20?,21?,22-/m1/s1 |
| InChIKey | PEEXBIHWSHEQHE-NQXYTMMNSA-N |
| XLogP | 2.67 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|