C23H32FN5O2 — CID 142130002
8-(cyclohexylamino)-7-[(2Z,4Z)-3-fluoro-2-propylhepta-2,4,6-trienyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 142130002) has the molecular formula C23H32FN5O2 and a molecular weight of 429.54 g/mol. Its IUPAC name is 8-(cyclohexylamino)-7-[(2Z,4Z)-3-fluoro-2-propylhepta-2,4,6-trienyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-(cyclohexylamino)-7-[(2Z,4Z)-3-fluoro-2-propylhepta-2,4,6-trienyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 142130002 |
| Molecular Formula | C23H32FN5O2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 8-(cyclohexylamino)-7-[(2Z,4Z)-3-fluoro-2-propylhepta-2,4,6-trienyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | C=C/C=C\C(F)=C(/CCC)Cn1c(NC2CCCCC2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C23H32FN5O2/c1-5-7-14-18(24)16(11-6-2)15-29-19-20(27(3)23(31)28(4)21(19)30)26-22(29)25-17-12-9-8-10-13-17/h5,7,14,17H,1,6,8-13,15H2,2-4H3,(H,25,26)/b14-7-,18-16- |
| InChIKey | INYXHQWDVGSLPZ-RCMPXGMESA-N |
| XLogP | 3.94 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|