About (2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine
(2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine (PubChem CID 142131672) has the molecular formula C8H10FN
and a molecular weight of 139.17 g/mol. Its IUPAC name is (2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine.
Analyze (2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine?
The IUPAC name of (2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine (CID 142131672) is (2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine.
What is the SMILES notation for (2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine?
The canonical SMILES for (2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine is NCC1=C(F)C=CCC=C1.
What is the InChIKey of (2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine?
The InChIKey is RNDZTOQAIDBZKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN/c9-8-5-3-1-2-4-7(8)6-10/h2-5H,1,6,10H2.
What are the key properties of (2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine?
(2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine has a molecular weight of 139.17 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorocyclohepta-1,3,6-trien-1-yl)methanamine is sourced from PubChem (CID 142131672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).