C32H35N5O3 — CID 142137096
1-[4-[6-cyano-7-[(2R)-2-methyl-3-piperidin-1-ylpropoxy]quinolin-4-yl]oxyphenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea (PubChem CID 142137096) has the molecular formula C32H35N5O3 and a molecular weight of 537.66 g/mol. Its IUPAC name is 1-[4-[6-cyano-7-[(2R)-2-methyl-3-piperidin-1-ylpropoxy]quinolin-4-yl]oxyphenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea.
| Compound Name | 1-[4-[6-cyano-7-[(2R)-2-methyl-3-piperidin-1-ylpropoxy]quinolin-4-yl]oxyphenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea |
|---|---|
| PubChem CID | 142137096 |
| Molecular Formula | C32H35N5O3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 1-[4-[6-cyano-7-[(2R)-2-methyl-3-piperidin-1-ylpropoxy]quinolin-4-yl]oxyphenyl]-3-[(3E)-hexa-1,3,5-trien-3-yl]urea |
| SMILES | C=C/C=C(\C=C)NC(=O)Nc1ccc(Oc2ccnc3cc(OC[C@H](C)CN4CCCCC4)c(C#N)cc23)cc1 |
| InChI | InChI=1S/C32H35N5O3/c1-4-9-25(5-2)35-32(38)36-26-10-12-27(13-11-26)40-30-14-15-34-29-19-31(24(20-33)18-28(29)30)39-22-23(3)21-37-16-7-6-8-17-37/h4-5,9-15,18-19,23H,1-2,6-8,16-17,21-22H2,3H3,(H2,35,36,38)/b25-9+/t23-/m1/s1 |
| InChIKey | DMYDBNRBCGPTKZ-IGRDWATOSA-N |
| XLogP | 6.78 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|