C17H31NO2S — CID 142146345
2',2'-diethyl-6',6'-dimethyl-1'-sulfanylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine] (PubChem CID 142146345) has the molecular formula C17H31NO2S and a molecular weight of 313.51 g/mol. Its IUPAC name is 2',2'-diethyl-6',6'-dimethyl-1'-sulfanylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine].
| Compound Name | 2',2'-diethyl-6',6'-dimethyl-1'-sulfanylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine] |
|---|---|
| PubChem CID | 142146345 |
| Molecular Formula | C17H31NO2S |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | 2',2'-diethyl-6',6'-dimethyl-1'-sulfanylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine] |
| SMILES | CCC1(CC)CC2(CC(C)(C)N1S)OC1CCCCC1O2 |
| InChI | InChI=1S/C17H31NO2S/c1-5-16(6-2)12-17(11-15(3,4)18(16)21)19-13-9-7-8-10-14(13)20-17/h13-14,21H,5-12H2,1-4H3 |
| InChIKey | ALHPFHCIEMHFAJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|