C15H31NO2S — CID 142146363
4,4-diethoxy-2,2-diethyl-6,6-dimethyl-1-sulfanylpiperidine (PubChem CID 142146363) has the molecular formula C15H31NO2S and a molecular weight of 289.49 g/mol. Its IUPAC name is 4,4-diethoxy-2,2-diethyl-6,6-dimethyl-1-sulfanylpiperidine.
| Compound Name | 4,4-diethoxy-2,2-diethyl-6,6-dimethyl-1-sulfanylpiperidine |
|---|---|
| PubChem CID | 142146363 |
| Molecular Formula | C15H31NO2S |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | 4,4-diethoxy-2,2-diethyl-6,6-dimethyl-1-sulfanylpiperidine |
| SMILES | CCOC1(OCC)CC(C)(C)N(S)C(CC)(CC)C1 |
| InChI | InChI=1S/C15H31NO2S/c1-7-14(8-2)12-15(17-9-3,18-10-4)11-13(5,6)16(14)19/h19H,7-12H2,1-6H3 |
| InChIKey | ZVZBTTLHGHFMQJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|